C13H21NO3 — CID 142238925
4-[[(2E,4Z)-5-methoxypenta-2,4-dienyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 142238925) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 4-[[(2E,4Z)-5-methoxypenta-2,4-dienyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(2E,4Z)-5-methoxypenta-2,4-dienyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 142238925 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-[[(2E,4Z)-5-methoxypenta-2,4-dienyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CO/C=C\C=C\CNC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C13H21NO3/c1-17-10-4-2-3-9-14-12-7-5-11(6-8-12)13(15)16/h2-4,10-12,14H,5-9H2,1H3,(H,15,16)/b3-2+,10-4- |
| InChIKey | YHCWOIXMKIBORL-VAIMCSMNSA-N |
| XLogP | 1.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|