C13H21NO3 — CID 142238938
4-[[(2E,4Z)-5-hydroxy-2-methylpenta-2,4-dienyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 142238938) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 4-[[(2E,4Z)-5-hydroxy-2-methylpenta-2,4-dienyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(2E,4Z)-5-hydroxy-2-methylpenta-2,4-dienyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 142238938 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-[[(2E,4Z)-5-hydroxy-2-methylpenta-2,4-dienyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | C/C(=C\C=C/O)CNC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C13H21NO3/c1-10(3-2-8-15)9-14-12-6-4-11(5-7-12)13(16)17/h2-3,8,11-12,14-15H,4-7,9H2,1H3,(H,16,17)/b8-2-,10-3+ |
| InChIKey | SSDWDPLUBXRXKD-AVBCCAMWSA-N |
| XLogP | 2.24 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|