C14H10N4O3S — CID 11404240
3-(3-nitrophenyl)sulfanyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide (PubChem CID 11404240) has the molecular formula C14H10N4O3S and a molecular weight of 314.33 g/mol. Its IUPAC name is 3-(3-nitrophenyl)sulfanyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide.
| Compound Name | 3-(3-nitrophenyl)sulfanyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11404240 |
| Molecular Formula | C14H10N4O3S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-(3-nitrophenyl)sulfanyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide |
| SMILES | NC(=O)c1[nH]c2cccnc2c1Sc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H10N4O3S/c15-14(19)12-13(11-10(17-12)5-2-6-16-11)22-9-4-1-3-8(7-9)18(20)21/h1-7,17H,(H2,15,19) |
| InChIKey | ZGOWLIXZICGZAW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|