About 2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine
2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine (PubChem CID 114044050) has the molecular formula C12H16ClN5
and a molecular weight of 265.75 g/mol. Its IUPAC name is 2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine.
Molecular Properties
| Compound Name | 2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine |
| PubChem CID | 114044050 |
| Molecular Formula | C12H16ClN5 |
| Molecular Weight | 265.75 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine |
| SMILES | CCc1cc(CC)n(-c2nc(Cl)nc(C)c2N)n1 |
| InChI | InChI=1S/C12H16ClN5/c1-4-8-6-9(5-2)18(17-8)11-10(14)7(3)15-12(13)16-11/h6H,4-5,14H2,1-3H3 |
| InChIKey | ZPWPBKAUTBOUAZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine?
The IUPAC name of 2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine (CID 114044050) is 2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine.
What is the SMILES notation for 2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine?
The canonical SMILES for 2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine is CCc1cc(CC)n(-c2nc(Cl)nc(C)c2N)n1.
What is the InChIKey of 2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine?
The InChIKey is ZPWPBKAUTBOUAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClN5/c1-4-8-6-9(5-2)18(17-8)11-10(14)7(3)15-12(13)16-11/h6H,4-5,14H2,1-3H3.
What are the key properties of 2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine?
2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine has a molecular weight of 265.75 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(3,5-diethylpyrazol-1-yl)-6-methylpyrimidin-5-amine is sourced from PubChem (CID 114044050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).