C18H28N2O3 — CID 11404430
(E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-[(4-methoxyphenyl)methoxy]butan-1-imine (PubChem CID 11404430) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-[(4-methoxyphenyl)methoxy]butan-1-imine.
| Compound Name | (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-[(4-methoxyphenyl)methoxy]butan-1-imine |
|---|---|
| PubChem CID | 11404430 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-[(4-methoxyphenyl)methoxy]butan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C/CCCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H28N2O3/c1-21-15-17-6-5-12-20(17)19-11-3-4-13-23-14-16-7-9-18(22-2)10-8-16/h7-11,17H,3-6,12-15H2,1-2H3/b19-11+/t17-/m0/s1 |
| InChIKey | FZUYHRBVYKUIPK-WAKXPGHKSA-N |
| XLogP | 3.09 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|