C10H15N5O2S — CID 114044762
4-(2,6-dimethylthiomorpholin-4-yl)-5-nitropyrimidin-2-amine (PubChem CID 114044762) has the molecular formula C10H15N5O2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-(2,6-dimethylthiomorpholin-4-yl)-5-nitropyrimidin-2-amine.
| Compound Name | 4-(2,6-dimethylthiomorpholin-4-yl)-5-nitropyrimidin-2-amine |
|---|---|
| PubChem CID | 114044762 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-(2,6-dimethylthiomorpholin-4-yl)-5-nitropyrimidin-2-amine |
| SMILES | CC1CN(c2nc(N)ncc2[N+](=O)[O-])CC(C)S1 |
| InChI | InChI=1S/C10H15N5O2S/c1-6-4-14(5-7(2)18-6)9-8(15(16)17)3-12-10(11)13-9/h3,6-7H,4-5H2,1-2H3,(H2,11,12,13) |
| InChIKey | XNXZMRMSWLLCST-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|