C14H22ClN3 — CID 114049259
6-chloro-5-methyl-N-(1,2,5-trimethylpiperidin-4-yl)pyridin-3-amine (PubChem CID 114049259) has the molecular formula C14H22ClN3 and a molecular weight of 267.80 g/mol. Its IUPAC name is 6-chloro-5-methyl-N-(1,2,5-trimethylpiperidin-4-yl)pyridin-3-amine.
| Compound Name | 6-chloro-5-methyl-N-(1,2,5-trimethylpiperidin-4-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 114049259 |
| Molecular Formula | C14H22ClN3 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 6-chloro-5-methyl-N-(1,2,5-trimethylpiperidin-4-yl)pyridin-3-amine |
| SMILES | Cc1cc(NC2CC(C)N(C)CC2C)cnc1Cl |
| InChI | InChI=1S/C14H22ClN3/c1-9-5-12(7-16-14(9)15)17-13-6-11(3)18(4)8-10(13)2/h5,7,10-11,13,17H,6,8H2,1-4H3 |
| InChIKey | XKFVCJKCKDJCIB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|