C10H13ClN4O2 — CID 114052865
N-(4-chloro-6-methylpyrimidin-2-yl)morpholine-2-carboxamide (PubChem CID 114052865) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is N-(4-chloro-6-methylpyrimidin-2-yl)morpholine-2-carboxamide.
| Compound Name | N-(4-chloro-6-methylpyrimidin-2-yl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 114052865 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-(4-chloro-6-methylpyrimidin-2-yl)morpholine-2-carboxamide |
| SMILES | Cc1cc(Cl)nc(NC(=O)C2CNCCO2)n1 |
| InChI | InChI=1S/C10H13ClN4O2/c1-6-4-8(11)14-10(13-6)15-9(16)7-5-12-2-3-17-7/h4,7,12H,2-3,5H2,1H3,(H,13,14,15,16) |
| InChIKey | UCVOBLIOQWZADV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |