C15H19NO2 — CID 114054257
2-(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-methylbenzaldehyde (PubChem CID 114054257) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-methylbenzaldehyde.
| Compound Name | 2-(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-methylbenzaldehyde |
|---|---|
| PubChem CID | 114054257 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-methylbenzaldehyde |
| SMILES | Cc1ccc(N2CC3CCC(O)C3C2)c(C=O)c1 |
| InChI | InChI=1S/C15H19NO2/c1-10-2-4-14(12(6-10)9-17)16-7-11-3-5-15(18)13(11)8-16/h2,4,6,9,11,13,15,18H,3,5,7-8H2,1H3 |
| InChIKey | WGQHYGXPWBOBGY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|