About N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine
N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine (PubChem CID 114056820) has the molecular formula C12H16N4S2
and a molecular weight of 280.42 g/mol. Its IUPAC name is N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine |
| PubChem CID | 114056820 |
| Molecular Formula | C12H16N4S2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1cccnc1Sc1nncs1 |
| InChI | InChI=1S/C12H16N4S2/c1-3-6-13-9(2)10-5-4-7-14-11(10)18-12-16-15-8-17-12/h4-5,7-9,13H,3,6H2,1-2H3 |
| InChIKey | SQJOFKAKOHCIKY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine?
The IUPAC name of N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine (CID 114056820) is N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine.
What is the SMILES notation for N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine?
The canonical SMILES for N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine is CCCNC(C)c1cccnc1Sc1nncs1.
What is the InChIKey of N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine?
The InChIKey is SQJOFKAKOHCIKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4S2/c1-3-6-13-9(2)10-5-4-7-14-11(10)18-12-16-15-8-17-12/h4-5,7-9,13H,3,6H2,1-2H3.
What are the key properties of N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine?
N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine has a molecular weight of 280.42 g/mol, XLogP of 3.14, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)-3-pyridinyl]ethyl]propan-1-amine is sourced from PubChem (CID 114056820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).