C11H12N2OS2 — CID 103960736
(1R)-1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]propan-1-ol (PubChem CID 103960736) has the molecular formula C11H12N2OS2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (1R)-1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]propan-1-ol.
| Compound Name | (1R)-1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 103960736 |
| Molecular Formula | C11H12N2OS2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | (1R)-1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]propan-1-ol |
| SMILES | CC[C@@H](O)c1ccccc1Sc1nncs1 |
| InChI | InChI=1S/C11H12N2OS2/c1-2-9(14)8-5-3-4-6-10(8)16-11-13-12-7-15-11/h3-7,9,14H,2H2,1H3/t9-/m1/s1 |
| InChIKey | ZOSZZFHZLWOAKV-SECBINFHSA-N |
| XLogP | 3.13 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |