C10H10N2OS2 — CID 63814151
1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]ethanol (PubChem CID 63814151) has the molecular formula C10H10N2OS2 and a molecular weight of 238.34 g/mol. Its IUPAC name is 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]ethanol.
| Compound Name | 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 63814151 |
| Molecular Formula | C10H10N2OS2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]ethanol |
| SMILES | CC(O)c1ccccc1Sc1nncs1 |
| InChI | InChI=1S/C10H10N2OS2/c1-7(13)8-4-2-3-5-9(8)15-10-12-11-6-14-10/h2-7,13H,1H3 |
| InChIKey | YGLFVMMWBRZQHI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |