C12H8F3NO3 — CID 114058122
5-ethyl-3-(2,4,5-trifluorophenyl)-1,2-oxazole-4-carboxylic acid (PubChem CID 114058122) has the molecular formula C12H8F3NO3 and a molecular weight of 271.19 g/mol. Its IUPAC name is 5-ethyl-3-(2,4,5-trifluorophenyl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 5-ethyl-3-(2,4,5-trifluorophenyl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114058122 |
| Molecular Formula | C12H8F3NO3 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 5-ethyl-3-(2,4,5-trifluorophenyl)-1,2-oxazole-4-carboxylic acid |
| SMILES | CCc1onc(-c2cc(F)c(F)cc2F)c1C(=O)O |
| InChI | InChI=1S/C12H8F3NO3/c1-2-9-10(12(17)18)11(16-19-9)5-3-7(14)8(15)4-6(5)13/h3-4H,2H2,1H3,(H,17,18) |
| InChIKey | IGZXXFRFBAFWJT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|