C10H3ClF3NO2 — CID 131867531
5-chloro-3-(2,4,5-trifluorophenyl)-1,2-oxazole-4-carbaldehyde (PubChem CID 131867531) has the molecular formula C10H3ClF3NO2 and a molecular weight of 261.59 g/mol. Its IUPAC name is 5-chloro-3-(2,4,5-trifluorophenyl)-1,2-oxazole-4-carbaldehyde.
| Compound Name | 5-chloro-3-(2,4,5-trifluorophenyl)-1,2-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 131867531 |
| Molecular Formula | C10H3ClF3NO2 |
| Molecular Weight | 261.59 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 5-chloro-3-(2,4,5-trifluorophenyl)-1,2-oxazole-4-carbaldehyde |
| SMILES | O=Cc1c(-c2cc(F)c(F)cc2F)noc1Cl |
| InChI | InChI=1S/C10H3ClF3NO2/c11-10-5(3-16)9(15-17-10)4-1-7(13)8(14)2-6(4)12/h1-3H |
| InChIKey | CDASCJMZPCWYCL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|