C18H12ClF3N2O3 — CID 142496601
3-[5-chloro-1-ethyl-6-oxo-2-(2,4,6-trifluorophenyl)-3-pyridinyl]-5-methyl-1,2-oxazole-4-carbaldehyde (PubChem CID 142496601) has the molecular formula C18H12ClF3N2O3 and a molecular weight of 396.75 g/mol. Its IUPAC name is 3-[5-chloro-1-ethyl-6-oxo-2-(2,4,6-trifluorophenyl)-3-pyridinyl]-5-methyl-1,2-oxazole-4-carbaldehyde.
| Compound Name | 3-[5-chloro-1-ethyl-6-oxo-2-(2,4,6-trifluorophenyl)-3-pyridinyl]-5-methyl-1,2-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 142496601 |
| Molecular Formula | C18H12ClF3N2O3 |
| Molecular Weight | 396.75 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 3-[5-chloro-1-ethyl-6-oxo-2-(2,4,6-trifluorophenyl)-3-pyridinyl]-5-methyl-1,2-oxazole-4-carbaldehyde |
| SMILES | CCn1c(-c2c(F)cc(F)cc2F)c(-c2noc(C)c2C=O)cc(Cl)c1=O |
| InChI | InChI=1S/C18H12ClF3N2O3/c1-3-24-17(15-13(21)4-9(20)5-14(15)22)10(6-12(19)18(24)26)16-11(7-25)8(2)27-23-16/h4-7H,3H2,1-2H3 |
| InChIKey | GUUKNPSOUKUUIF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.75 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|