C18H15F3N2O3 — CID 11405842
4-(3-cyanophenyl)-5-oxo-2-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-quinoline-3-carboxylic acid (PubChem CID 11405842) has the molecular formula C18H15F3N2O3 and a molecular weight of 364.32 g/mol. Its IUPAC name is 4-(3-cyanophenyl)-5-oxo-2-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-quinoline-3-carboxylic acid.
| Compound Name | 4-(3-cyanophenyl)-5-oxo-2-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 11405842 |
| Molecular Formula | C18H15F3N2O3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 4-(3-cyanophenyl)-5-oxo-2-(trifluoromethyl)-2,3,4,6,7,8-hexahydro-1H-quinoline-3-carboxylic acid |
| SMILES | N#Cc1cccc(C2C3=C(CCCC3=O)NC(C(F)(F)F)C2C(=O)O)c1 |
| InChI | InChI=1S/C18H15F3N2O3/c19-18(20,21)16-15(17(25)26)13(10-4-1-3-9(7-10)8-22)14-11(23-16)5-2-6-12(14)24/h1,3-4,7,13,15-16,23H,2,5-6H2,(H,25,26) |
| InChIKey | CWWXROSKRGXMDX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |