C13H19FN2S — CID 114058661
1-[3-fluoro-2-(1,4-thiazepan-4-yl)phenyl]ethanamine (PubChem CID 114058661) has the molecular formula C13H19FN2S and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-[3-fluoro-2-(1,4-thiazepan-4-yl)phenyl]ethanamine.
| Compound Name | 1-[3-fluoro-2-(1,4-thiazepan-4-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 114058661 |
| Molecular Formula | C13H19FN2S |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-[3-fluoro-2-(1,4-thiazepan-4-yl)phenyl]ethanamine |
| SMILES | CC(N)c1cccc(F)c1N1CCCSCC1 |
| InChI | InChI=1S/C13H19FN2S/c1-10(15)11-4-2-5-12(14)13(11)16-6-3-8-17-9-7-16/h2,4-5,10H,3,6-9,15H2,1H3 |
| InChIKey | SKKHZUZKVLUNAI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |