C13H16F3NS — CID 175324246
1-[2-(4,4-difluoropiperidin-1-yl)-3-fluorophenyl]ethanethiol (PubChem CID 175324246) has the molecular formula C13H16F3NS and a molecular weight of 275.34 g/mol. Its IUPAC name is 1-[2-(4,4-difluoropiperidin-1-yl)-3-fluorophenyl]ethanethiol.
| Compound Name | 1-[2-(4,4-difluoropiperidin-1-yl)-3-fluorophenyl]ethanethiol |
|---|---|
| PubChem CID | 175324246 |
| Molecular Formula | C13H16F3NS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 1-[2-(4,4-difluoropiperidin-1-yl)-3-fluorophenyl]ethanethiol |
| SMILES | CC(S)c1cccc(F)c1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H16F3NS/c1-9(18)10-3-2-4-11(14)12(10)17-7-5-13(15,16)6-8-17/h2-4,9,18H,5-8H2,1H3 |
| InChIKey | VFIFQPGLEKIVJA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|