C12H13F4NO — CID 177192883
1-(2,3-difluoro-6-methoxyphenyl)-4,4-difluoropiperidine (PubChem CID 177192883) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is 1-(2,3-difluoro-6-methoxyphenyl)-4,4-difluoropiperidine.
| Compound Name | 1-(2,3-difluoro-6-methoxyphenyl)-4,4-difluoropiperidine |
|---|---|
| PubChem CID | 177192883 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-(2,3-difluoro-6-methoxyphenyl)-4,4-difluoropiperidine |
| SMILES | COc1ccc(F)c(F)c1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H13F4NO/c1-18-9-3-2-8(13)10(14)11(9)17-6-4-12(15,16)5-7-17/h2-3H,4-7H2,1H3 |
| InChIKey | VHPXPSXSEMQEQL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |