C12H14FN3O2 — CID 114065682
4-[3-fluoro-2-(methylaminomethyl)phenyl]piperazine-2,6-dione (PubChem CID 114065682) has the molecular formula C12H14FN3O2 and a molecular weight of 251.26 g/mol. Its IUPAC name is 4-[3-fluoro-2-(methylaminomethyl)phenyl]piperazine-2,6-dione.
| Compound Name | 4-[3-fluoro-2-(methylaminomethyl)phenyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 114065682 |
| Molecular Formula | C12H14FN3O2 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 4-[3-fluoro-2-(methylaminomethyl)phenyl]piperazine-2,6-dione |
| SMILES | CNCc1c(F)cccc1N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C12H14FN3O2/c1-14-5-8-9(13)3-2-4-10(8)16-6-11(17)15-12(18)7-16/h2-4,14H,5-7H2,1H3,(H,15,17,18) |
| InChIKey | BRWOPEVTGGYBBW-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|