C12H17FN2O2S — CID 114065973
2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorophenyl]ethanamine (PubChem CID 114065973) has the molecular formula C12H17FN2O2S and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorophenyl]ethanamine.
| Compound Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorophenyl]ethanamine |
|---|---|
| PubChem CID | 114065973 |
| Molecular Formula | C12H17FN2O2S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorophenyl]ethanamine |
| SMILES | NCCc1c(F)cccc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H17FN2O2S/c13-11-2-1-3-12(10(11)4-5-14)15-6-8-18(16,17)9-7-15/h1-3H,4-9,14H2 |
| InChIKey | HAGIRYZOYZYCIA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |