C13H19FN2O — CID 114065996
2-[2-fluoro-6-(1,4-oxazepan-4-yl)phenyl]ethanamine (PubChem CID 114065996) has the molecular formula C13H19FN2O and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-[2-fluoro-6-(1,4-oxazepan-4-yl)phenyl]ethanamine.
| Compound Name | 2-[2-fluoro-6-(1,4-oxazepan-4-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 114065996 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-[2-fluoro-6-(1,4-oxazepan-4-yl)phenyl]ethanamine |
| SMILES | NCCc1c(F)cccc1N1CCCOCC1 |
| InChI | InChI=1S/C13H19FN2O/c14-12-3-1-4-13(11(12)5-6-15)16-7-2-9-17-10-8-16/h1,3-4H,2,5-10,15H2 |
| InChIKey | OZZSITZIWFUSHE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |