C11H11FN4O — CID 114069150
1-[2-(aminomethyl)-6-fluorophenyl]pyrazole-4-carboxamide (PubChem CID 114069150) has the molecular formula C11H11FN4O and a molecular weight of 234.23 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-6-fluorophenyl]pyrazole-4-carboxamide.
| Compound Name | 1-[2-(aminomethyl)-6-fluorophenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 114069150 |
| Molecular Formula | C11H11FN4O |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 1-[2-(aminomethyl)-6-fluorophenyl]pyrazole-4-carboxamide |
| SMILES | NCc1cccc(F)c1-n1cc(C(N)=O)cn1 |
| InChI | InChI=1S/C11H11FN4O/c12-9-3-1-2-7(4-13)10(9)16-6-8(5-15-16)11(14)17/h1-3,5-6H,4,13H2,(H2,14,17) |
| InChIKey | UMORBSGOWISZQD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |