C9H11Br2N3O4S — CID 114073780
ethyl 3-[(3,5-dibromopyrazin-2-yl)sulfamoyl]propanoate (PubChem CID 114073780) has the molecular formula C9H11Br2N3O4S and a molecular weight of 417.08 g/mol. Its IUPAC name is ethyl 3-[(3,5-dibromopyrazin-2-yl)sulfamoyl]propanoate.
| Compound Name | ethyl 3-[(3,5-dibromopyrazin-2-yl)sulfamoyl]propanoate |
|---|---|
| PubChem CID | 114073780 |
| Molecular Formula | C9H11Br2N3O4S |
| Molecular Weight | 417.08 g/mol |
| Exact Mass | 414.88 |
| IUPAC Name | ethyl 3-[(3,5-dibromopyrazin-2-yl)sulfamoyl]propanoate |
| SMILES | CCOC(=O)CCS(=O)(=O)Nc1ncc(Br)nc1Br |
| InChI | InChI=1S/C9H11Br2N3O4S/c1-2-18-7(15)3-4-19(16,17)14-9-8(11)13-6(10)5-12-9/h5H,2-4H2,1H3,(H,12,14) |
| InChIKey | HIXWZZRBKYPMMG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.08 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |