About 6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine
6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine (PubChem CID 114073969) has the molecular formula C11H7ClF3N3
and a molecular weight of 273.65 g/mol. Its IUPAC name is 6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine.
Molecular Properties
| Compound Name | 6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine |
| PubChem CID | 114073969 |
| Molecular Formula | C11H7ClF3N3 |
| Molecular Weight | 273.65 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine |
| SMILES | Nc1nc(Nc2cccc(Cl)c2F)c(F)cc1F |
| InChI | InChI=1S/C11H7ClF3N3/c12-5-2-1-3-8(9(5)15)17-11-7(14)4-6(13)10(16)18-11/h1-4H,(H3,16,17,18) |
| InChIKey | GXBVKXHMMLAFPO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine?
The IUPAC name of 6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine (CID 114073969) is 6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine.
What is the SMILES notation for 6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine?
The canonical SMILES for 6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine is Nc1nc(Nc2cccc(Cl)c2F)c(F)cc1F.
What is the InChIKey of 6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine?
The InChIKey is GXBVKXHMMLAFPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClF3N3/c12-5-2-1-3-8(9(5)15)17-11-7(14)4-6(13)10(16)18-11/h1-4H,(H3,16,17,18).
What are the key properties of 6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine?
6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine has a molecular weight of 273.65 g/mol, XLogP of 3.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-(3-chloro-2-fluorophenyl)-3,5-difluoropyridine-2,6-diamine is sourced from PubChem (CID 114073969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).