C11H11F2N3S — CID 114074049
3,5-difluoro-6-N-(2-thiophen-2-ylethyl)pyridine-2,6-diamine (PubChem CID 114074049) has the molecular formula C11H11F2N3S and a molecular weight of 255.29 g/mol. Its IUPAC name is 3,5-difluoro-6-N-(2-thiophen-2-ylethyl)pyridine-2,6-diamine.
| Compound Name | 3,5-difluoro-6-N-(2-thiophen-2-ylethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 114074049 |
| Molecular Formula | C11H11F2N3S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 3,5-difluoro-6-N-(2-thiophen-2-ylethyl)pyridine-2,6-diamine |
| SMILES | Nc1nc(NCCc2cccs2)c(F)cc1F |
| InChI | InChI=1S/C11H11F2N3S/c12-8-6-9(13)11(16-10(8)14)15-4-3-7-2-1-5-17-7/h1-2,5-6H,3-4H2,(H3,14,15,16) |
| InChIKey | MTYUTKKUUMXZCF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |