C25H46O4Si — CID 11407999
(1'S,4'aS,8'aS)-1',4'a-dimethyl-1'-[2-tri(propan-2-yl)silyloxyethyl]spiro[1,3-dioxolane-2,5'-6,7,8,8a-tetrahydro-2H-naphthalene]-2'-ol (PubChem CID 11407999) has the molecular formula C25H46O4Si and a molecular weight of 438.73 g/mol. Its IUPAC name is (1'S,4'aS,8'aS)-1',4'a-dimethyl-1'-[2-tri(propan-2-yl)silyloxyethyl]spiro[1,3-dioxolane-2,5'-6,7,8,8a-tetrahydro-2H-naphthalene]-2'-ol.
| Compound Name | (1'S,4'aS,8'aS)-1',4'a-dimethyl-1'-[2-tri(propan-2-yl)silyloxyethyl]spiro[1,3-dioxolane-2,5'-6,7,8,8a-tetrahydro-2H-naphthalene]-2'-ol |
|---|---|
| PubChem CID | 11407999 |
| Molecular Formula | C25H46O4Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | (1'S,4'aS,8'aS)-1',4'a-dimethyl-1'-[2-tri(propan-2-yl)silyloxyethyl]spiro[1,3-dioxolane-2,5'-6,7,8,8a-tetrahydro-2H-naphthalene]-2'-ol |
| SMILES | CC(C)[Si](OCC[C@]1(C)C(O)C=C[C@@]2(C)[C@H]1CCCC21OCCO1)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H46O4Si/c1-18(2)30(19(3)4,20(5)6)29-15-14-23(7)21-10-9-12-25(27-16-17-28-25)24(21,8)13-11-22(23)26/h11,13,18-22,26H,9-10,12,14-17H2,1-8H3/t21-,22?,23-,24-/m0/s1 |
| InChIKey | PHICGEVYPDLTOT-CNTOOOFYSA-N |
| XLogP | 6.06 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|