C27H28N2O4 — CID 11408162
1-(4-tert-butyl-3-methoxybenzoyl)-2-(pyridin-3-ylmethyl)-3H-indole-2-carboxylic acid (PubChem CID 11408162) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 1-(4-tert-butyl-3-methoxybenzoyl)-2-(pyridin-3-ylmethyl)-3H-indole-2-carboxylic acid.
| Compound Name | 1-(4-tert-butyl-3-methoxybenzoyl)-2-(pyridin-3-ylmethyl)-3H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 11408162 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 1-(4-tert-butyl-3-methoxybenzoyl)-2-(pyridin-3-ylmethyl)-3H-indole-2-carboxylic acid |
| SMILES | COc1cc(C(=O)N2c3ccccc3CC2(Cc2cccnc2)C(=O)O)ccc1C(C)(C)C |
| InChI | InChI=1S/C27H28N2O4/c1-26(2,3)21-12-11-19(14-23(21)33-4)24(30)29-22-10-6-5-9-20(22)16-27(29,25(31)32)15-18-8-7-13-28-17-18/h5-14,17H,15-16H2,1-4H3,(H,31,32) |
| InChIKey | IAXFGQPLTDOPDJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |