C33H35NO6 — CID 90922899
benzyl 1-(4-tert-butyl-3-methoxybenzoyl)-4-(3-methoxy-3-oxoprop-1-enyl)-2-methyl-3H-indole-2-carboxylate (PubChem CID 90922899) has the molecular formula C33H35NO6 and a molecular weight of 541.64 g/mol. Its IUPAC name is benzyl 1-(4-tert-butyl-3-methoxybenzoyl)-4-(3-methoxy-3-oxoprop-1-enyl)-2-methyl-3H-indole-2-carboxylate.
| Compound Name | benzyl 1-(4-tert-butyl-3-methoxybenzoyl)-4-(3-methoxy-3-oxoprop-1-enyl)-2-methyl-3H-indole-2-carboxylate |
|---|---|
| PubChem CID | 90922899 |
| Molecular Formula | C33H35NO6 |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | benzyl 1-(4-tert-butyl-3-methoxybenzoyl)-4-(3-methoxy-3-oxoprop-1-enyl)-2-methyl-3H-indole-2-carboxylate |
| SMILES | COC(=O)C=Cc1cccc2c1CC(C)(C(=O)OCc1ccccc1)N2C(=O)c1ccc(C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C33H35NO6/c1-32(2,3)26-17-15-24(19-28(26)38-5)30(36)34-27-14-10-13-23(16-18-29(35)39-6)25(27)20-33(34,4)31(37)40-21-22-11-8-7-9-12-22/h7-19H,20-21H2,1-6H3 |
| InChIKey | CNZQSYPSGUWXEJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|