C23H26N2O4 — CID 59727907
benzyl 4-(4-methoxy-3-prop-2-enylbenzoyl)piperazine-1-carboxylate (PubChem CID 59727907) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is benzyl 4-(4-methoxy-3-prop-2-enylbenzoyl)piperazine-1-carboxylate.
| Compound Name | benzyl 4-(4-methoxy-3-prop-2-enylbenzoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59727907 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | benzyl 4-(4-methoxy-3-prop-2-enylbenzoyl)piperazine-1-carboxylate |
| SMILES | C=CCc1cc(C(=O)N2CCN(C(=O)OCc3ccccc3)CC2)ccc1OC |
| InChI | InChI=1S/C23H26N2O4/c1-3-7-19-16-20(10-11-21(19)28-2)22(26)24-12-14-25(15-13-24)23(27)29-17-18-8-5-4-6-9-18/h3-6,8-11,16H,1,7,12-15,17H2,2H3 |
| InChIKey | LFQBSIIURHHKBS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|