C21H23FN2O3 — CID 110809156
benzyl 4-(4-fluoro-3-methylbenzoyl)-1,4-diazepane-1-carboxylate (PubChem CID 110809156) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is benzyl 4-(4-fluoro-3-methylbenzoyl)-1,4-diazepane-1-carboxylate.
| Compound Name | benzyl 4-(4-fluoro-3-methylbenzoyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 110809156 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | benzyl 4-(4-fluoro-3-methylbenzoyl)-1,4-diazepane-1-carboxylate |
| SMILES | Cc1cc(C(=O)N2CCCN(C(=O)OCc3ccccc3)CC2)ccc1F |
| InChI | InChI=1S/C21H23FN2O3/c1-16-14-18(8-9-19(16)22)20(25)23-10-5-11-24(13-12-23)21(26)27-15-17-6-3-2-4-7-17/h2-4,6-9,14H,5,10-13,15H2,1H3 |
| InChIKey | BUWCCYVHLHQPCI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |