C21H23FN2O3 — CID 110366473
benzyl 4-[2-(4-fluoro-3-methylphenyl)-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 110366473) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is benzyl 4-[2-(4-fluoro-3-methylphenyl)-2-oxoethyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[2-(4-fluoro-3-methylphenyl)-2-oxoethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110366473 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | benzyl 4-[2-(4-fluoro-3-methylphenyl)-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | Cc1cc(C(=O)CN2CCN(C(=O)OCc3ccccc3)CC2)ccc1F |
| InChI | InChI=1S/C21H23FN2O3/c1-16-13-18(7-8-19(16)22)20(25)14-23-9-11-24(12-10-23)21(26)27-15-17-5-3-2-4-6-17/h2-8,13H,9-12,14-15H2,1H3 |
| InChIKey | KCEFYWWXJGPYGP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |