C26H34N2O4 — CID 143091664
methyl 2-benzyl-1-(4-tert-butyl-3-methoxybenzoyl)-4-methylpiperazine-2-carboxylate (PubChem CID 143091664) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is methyl 2-benzyl-1-(4-tert-butyl-3-methoxybenzoyl)-4-methylpiperazine-2-carboxylate.
| Compound Name | methyl 2-benzyl-1-(4-tert-butyl-3-methoxybenzoyl)-4-methylpiperazine-2-carboxylate |
|---|---|
| PubChem CID | 143091664 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | methyl 2-benzyl-1-(4-tert-butyl-3-methoxybenzoyl)-4-methylpiperazine-2-carboxylate |
| SMILES | COC(=O)C1(Cc2ccccc2)CN(C)CCN1C(=O)c1ccc(C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C26H34N2O4/c1-25(2,3)21-13-12-20(16-22(21)31-5)23(29)28-15-14-27(4)18-26(28,24(30)32-6)17-19-10-8-7-9-11-19/h7-13,16H,14-15,17-18H2,1-6H3 |
| InChIKey | IZPQVRRRNDTBAO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |