C10H15N3O3S2 — CID 114081677
1-(4-aminothiophen-2-yl)sulfonyl-3-methylpyrrolidine-3-carboxamide (PubChem CID 114081677) has the molecular formula C10H15N3O3S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-(4-aminothiophen-2-yl)sulfonyl-3-methylpyrrolidine-3-carboxamide.
| Compound Name | 1-(4-aminothiophen-2-yl)sulfonyl-3-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 114081677 |
| Molecular Formula | C10H15N3O3S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 1-(4-aminothiophen-2-yl)sulfonyl-3-methylpyrrolidine-3-carboxamide |
| SMILES | CC1(C(N)=O)CCN(S(=O)(=O)c2cc(N)cs2)C1 |
| InChI | InChI=1S/C10H15N3O3S2/c1-10(9(12)14)2-3-13(6-10)18(15,16)8-4-7(11)5-17-8/h4-5H,2-3,6,11H2,1H3,(H2,12,14) |
| InChIKey | XMRLYOJWUHBUBR-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |