C12H11Cl3N2S — CID 114082835
2-chloro-N-[1-(2,5-dichlorothiophen-3-yl)ethyl]-5-methylpyridin-3-amine (PubChem CID 114082835) has the molecular formula C12H11Cl3N2S and a molecular weight of 321.66 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,5-dichlorothiophen-3-yl)ethyl]-5-methylpyridin-3-amine.
| Compound Name | 2-chloro-N-[1-(2,5-dichlorothiophen-3-yl)ethyl]-5-methylpyridin-3-amine |
|---|---|
| PubChem CID | 114082835 |
| Molecular Formula | C12H11Cl3N2S |
| Molecular Weight | 321.66 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 2-chloro-N-[1-(2,5-dichlorothiophen-3-yl)ethyl]-5-methylpyridin-3-amine |
| SMILES | Cc1cnc(Cl)c(NC(C)c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C12H11Cl3N2S/c1-6-3-9(11(14)16-5-6)17-7(2)8-4-10(13)18-12(8)15/h3-5,7,17H,1-2H3 |
| InChIKey | KNKXROMCKUDKBQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|