C11H18N2O2S2 — CID 114083369
2-(1,1-dioxo-1,4-thiazepan-4-yl)-2-thiophen-2-ylethanamine (PubChem CID 114083369) has the molecular formula C11H18N2O2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazepan-4-yl)-2-thiophen-2-ylethanamine.
| Compound Name | 2-(1,1-dioxo-1,4-thiazepan-4-yl)-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 114083369 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazepan-4-yl)-2-thiophen-2-ylethanamine |
| SMILES | NCC(c1cccs1)N1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H18N2O2S2/c12-9-10(11-3-1-6-16-11)13-4-2-7-17(14,15)8-5-13/h1,3,6,10H,2,4-5,7-9,12H2 |
| InChIKey | FMSRSSQHYQDFEO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |