C16H26N2S — CID 62935626
2-(3-azaspiro[5.5]undecan-3-yl)-2-thiophen-2-ylethanamine (PubChem CID 62935626) has the molecular formula C16H26N2S and a molecular weight of 278.46 g/mol. Its IUPAC name is 2-(3-azaspiro[5.5]undecan-3-yl)-2-thiophen-2-ylethanamine.
| Compound Name | 2-(3-azaspiro[5.5]undecan-3-yl)-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 62935626 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-(3-azaspiro[5.5]undecan-3-yl)-2-thiophen-2-ylethanamine |
| SMILES | NCC(c1cccs1)N1CCC2(CCCCC2)CC1 |
| InChI | InChI=1S/C16H26N2S/c17-13-14(15-5-4-12-19-15)18-10-8-16(9-11-18)6-2-1-3-7-16/h4-5,12,14H,1-3,6-11,13,17H2 |
| InChIKey | JSQVFFLTJCOUJV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |