C12H26N2O2S — CID 114083776
N-[2-(1,1-dioxo-1,4-thiazepan-4-yl)ethyl]pentan-3-amine (PubChem CID 114083776) has the molecular formula C12H26N2O2S and a molecular weight of 262.42 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,4-thiazepan-4-yl)ethyl]pentan-3-amine.
| Compound Name | N-[2-(1,1-dioxo-1,4-thiazepan-4-yl)ethyl]pentan-3-amine |
|---|---|
| PubChem CID | 114083776 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-[2-(1,1-dioxo-1,4-thiazepan-4-yl)ethyl]pentan-3-amine |
| SMILES | CCC(CC)NCCN1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H26N2O2S/c1-3-12(4-2)13-6-8-14-7-5-10-17(15,16)11-9-14/h12-13H,3-11H2,1-2H3 |
| InChIKey | DBUUNWOHYSLLMS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |