C13H28N4O4S2 — CID 22326506
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]hydrazine (PubChem CID 22326506) has the molecular formula C13H28N4O4S2 and a molecular weight of 368.53 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]hydrazine.
| Compound Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 22326506 |
| Molecular Formula | C13H28N4O4S2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]hydrazine |
| SMILES | O=S1(=O)CCN(CCCNNCCN2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C13H28N4O4S2/c18-22(19)10-6-16(7-11-22)4-1-2-14-15-3-5-17-8-12-23(20,21)13-9-17/h14-15H,1-13H2 |
| InChIKey | RIOGBKBBMBZTDW-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|