C17H31N3O3S — CID 167956442
1-(3-bicyclo[3.3.1]nonanyl)-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]urea (PubChem CID 167956442) has the molecular formula C17H31N3O3S and a molecular weight of 357.52 g/mol. Its IUPAC name is 1-(3-bicyclo[3.3.1]nonanyl)-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]urea.
| Compound Name | 1-(3-bicyclo[3.3.1]nonanyl)-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]urea |
|---|---|
| PubChem CID | 167956442 |
| Molecular Formula | C17H31N3O3S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-(3-bicyclo[3.3.1]nonanyl)-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]urea |
| SMILES | O=C(NCCCN1CCS(=O)(=O)CC1)NC1CC2CCCC(C2)C1 |
| InChI | InChI=1S/C17H31N3O3S/c21-17(19-16-12-14-3-1-4-15(11-14)13-16)18-5-2-6-20-7-9-24(22,23)10-8-20/h14-16H,1-13H2,(H2,18,19,21) |
| InChIKey | UMLORXIQOYPZOL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|