C12H20N4O2S2 — CID 133434429
3-cyclopropyl-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-1,2,4-thiadiazol-5-amine (PubChem CID 133434429) has the molecular formula C12H20N4O2S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 3-cyclopropyl-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-cyclopropyl-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 133434429 |
| Molecular Formula | C12H20N4O2S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3-cyclopropyl-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-1,2,4-thiadiazol-5-amine |
| SMILES | O=S1(=O)CCN(CCCNc2nc(C3CC3)ns2)CC1 |
| InChI | InChI=1S/C12H20N4O2S2/c17-20(18)8-6-16(7-9-20)5-1-4-13-12-14-11(15-19-12)10-2-3-10/h10H,1-9H2,(H,13,14,15) |
| InChIKey | HPIHMEHEUHHRCD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|