C13H20ClN3O — CID 114089562
5-amino-2-chloro-N-(2,3,3-trimethylbutyl)pyridine-4-carboxamide (PubChem CID 114089562) has the molecular formula C13H20ClN3O and a molecular weight of 269.78 g/mol. Its IUPAC name is 5-amino-2-chloro-N-(2,3,3-trimethylbutyl)pyridine-4-carboxamide.
| Compound Name | 5-amino-2-chloro-N-(2,3,3-trimethylbutyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114089562 |
| Molecular Formula | C13H20ClN3O |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 5-amino-2-chloro-N-(2,3,3-trimethylbutyl)pyridine-4-carboxamide |
| SMILES | CC(CNC(=O)c1cc(Cl)ncc1N)C(C)(C)C |
| InChI | InChI=1S/C13H20ClN3O/c1-8(13(2,3)4)6-17-12(18)9-5-11(14)16-7-10(9)15/h5,7-8H,6,15H2,1-4H3,(H,17,18) |
| InChIKey | XJVQOZFXLSCPDH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|