C10H14ClN3O2S — CID 114089576
5-amino-2-chloro-N-(1-methylsulfinylpropan-2-yl)pyridine-4-carboxamide (PubChem CID 114089576) has the molecular formula C10H14ClN3O2S and a molecular weight of 275.76 g/mol. Its IUPAC name is 5-amino-2-chloro-N-(1-methylsulfinylpropan-2-yl)pyridine-4-carboxamide.
| Compound Name | 5-amino-2-chloro-N-(1-methylsulfinylpropan-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114089576 |
| Molecular Formula | C10H14ClN3O2S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 5-amino-2-chloro-N-(1-methylsulfinylpropan-2-yl)pyridine-4-carboxamide |
| SMILES | CC(CS(C)=O)NC(=O)c1cc(Cl)ncc1N |
| InChI | InChI=1S/C10H14ClN3O2S/c1-6(5-17(2)16)14-10(15)7-3-9(11)13-4-8(7)12/h3-4,6H,5,12H2,1-2H3,(H,14,15) |
| InChIKey | SOEYBDCFBFODSG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|