C12H17N5O2 — CID 114090352
5-amino-2-[2-cyanoethyl(2-methoxyethyl)amino]pyridine-4-carboxamide (PubChem CID 114090352) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 5-amino-2-[2-cyanoethyl(2-methoxyethyl)amino]pyridine-4-carboxamide.
| Compound Name | 5-amino-2-[2-cyanoethyl(2-methoxyethyl)amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114090352 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 5-amino-2-[2-cyanoethyl(2-methoxyethyl)amino]pyridine-4-carboxamide |
| SMILES | COCCN(CCC#N)c1cc(C(N)=O)c(N)cn1 |
| InChI | InChI=1S/C12H17N5O2/c1-19-6-5-17(4-2-3-13)11-7-9(12(15)18)10(14)8-16-11/h7-8H,2,4-6,14H2,1H3,(H2,15,18) |
| InChIKey | BLRHAPCHZYZUBM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 118.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |