C13H21N3O3 — CID 114090593
ethyl 5-amino-2-(2-ethoxypropylamino)pyridine-4-carboxylate (PubChem CID 114090593) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is ethyl 5-amino-2-(2-ethoxypropylamino)pyridine-4-carboxylate.
| Compound Name | ethyl 5-amino-2-(2-ethoxypropylamino)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 114090593 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | ethyl 5-amino-2-(2-ethoxypropylamino)pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(NCC(C)OCC)ncc1N |
| InChI | InChI=1S/C13H21N3O3/c1-4-18-9(3)7-15-12-6-10(11(14)8-16-12)13(17)19-5-2/h6,8-9H,4-5,7,14H2,1-3H3,(H,15,16) |
| InChIKey | MJNKRPXKXHFXDT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |