C11H14F3N3O2S — CID 106432611
ethyl 5-amino-2-[2-(trifluoromethylsulfanyl)ethylamino]pyridine-4-carboxylate (PubChem CID 106432611) has the molecular formula C11H14F3N3O2S and a molecular weight of 309.31 g/mol. Its IUPAC name is ethyl 5-amino-2-[2-(trifluoromethylsulfanyl)ethylamino]pyridine-4-carboxylate.
| Compound Name | ethyl 5-amino-2-[2-(trifluoromethylsulfanyl)ethylamino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 106432611 |
| Molecular Formula | C11H14F3N3O2S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | ethyl 5-amino-2-[2-(trifluoromethylsulfanyl)ethylamino]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(NCCSC(F)(F)F)ncc1N |
| InChI | InChI=1S/C11H14F3N3O2S/c1-2-19-10(18)7-5-9(17-6-8(7)15)16-3-4-20-11(12,13)14/h5-6H,2-4,15H2,1H3,(H,16,17) |
| InChIKey | AELKOXFQHHNUCH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|