C12H18N4O3 — CID 114090508
ethyl 5-amino-2-(morpholin-4-ylamino)pyridine-4-carboxylate (PubChem CID 114090508) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is ethyl 5-amino-2-(morpholin-4-ylamino)pyridine-4-carboxylate.
| Compound Name | ethyl 5-amino-2-(morpholin-4-ylamino)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 114090508 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | ethyl 5-amino-2-(morpholin-4-ylamino)pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(NN2CCOCC2)ncc1N |
| InChI | InChI=1S/C12H18N4O3/c1-2-19-12(17)9-7-11(14-8-10(9)13)15-16-3-5-18-6-4-16/h7-8H,2-6,13H2,1H3,(H,14,15) |
| InChIKey | HOOQXGPZPLGSGR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |