C25H30O3Sn — CID 11409365
ethyl (2E,5E)-8-oxo-3,8-diphenyl-2-trimethylstannylocta-2,5-dienoate (PubChem CID 11409365) has the molecular formula C25H30O3Sn and a molecular weight of 497.22 g/mol. Its IUPAC name is ethyl (2E,5E)-8-oxo-3,8-diphenyl-2-trimethylstannylocta-2,5-dienoate.
| Compound Name | ethyl (2E,5E)-8-oxo-3,8-diphenyl-2-trimethylstannylocta-2,5-dienoate |
|---|---|
| PubChem CID | 11409365 |
| Molecular Formula | C25H30O3Sn |
| Molecular Weight | 497.22 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | ethyl (2E,5E)-8-oxo-3,8-diphenyl-2-trimethylstannylocta-2,5-dienoate |
| SMILES | CCOC(=O)/C(=C(/C/C=C/CC(=O)c1ccccc1)c1ccccc1)[Sn](C)(C)C |
| InChI | InChI=1S/C22H21O3.3CH3.Sn/c1-2-25-22(24)17-20(18-11-5-3-6-12-18)15-9-10-16-21(23)19-13-7-4-8-14-19;;;;/h3-14H,2,15-16H2,1H3;3*1H3;/b10-9+,20-17?;;;; |
| InChIKey | KDIMBUQIHLOWSU-JIFPHJLJSA-N |
| XLogP | 6.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.22 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|