C14H20N4 — CID 114094754
5-amino-2-[(1-methylcyclohexyl)methylamino]pyridine-3-carbonitrile (PubChem CID 114094754) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 5-amino-2-[(1-methylcyclohexyl)methylamino]pyridine-3-carbonitrile.
| Compound Name | 5-amino-2-[(1-methylcyclohexyl)methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 114094754 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 5-amino-2-[(1-methylcyclohexyl)methylamino]pyridine-3-carbonitrile |
| SMILES | CC1(CNc2ncc(N)cc2C#N)CCCCC1 |
| InChI | InChI=1S/C14H20N4/c1-14(5-3-2-4-6-14)10-18-13-11(8-15)7-12(16)9-17-13/h7,9H,2-6,10,16H2,1H3,(H,17,18) |
| InChIKey | YEOYCSNOYZYVKY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |