C15H18FNO — CID 114095653
3-fluoro-5-[(3-tricyclo[3.2.1.02,4]octanylamino)methyl]phenol (PubChem CID 114095653) has the molecular formula C15H18FNO and a molecular weight of 247.31 g/mol. Its IUPAC name is 3-fluoro-5-[(3-tricyclo[3.2.1.02,4]octanylamino)methyl]phenol.
| Compound Name | 3-fluoro-5-[(3-tricyclo[3.2.1.02,4]octanylamino)methyl]phenol |
|---|---|
| PubChem CID | 114095653 |
| Molecular Formula | C15H18FNO |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-fluoro-5-[(3-tricyclo[3.2.1.02,4]octanylamino)methyl]phenol |
| SMILES | Oc1cc(F)cc(CNC2C3C4CCC(C4)C23)c1 |
| InChI | InChI=1S/C15H18FNO/c16-11-3-8(4-12(18)6-11)7-17-15-13-9-1-2-10(5-9)14(13)15/h3-4,6,9-10,13-15,17-18H,1-2,5,7H2 |
| InChIKey | GSMNHQYOKWOIEO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |